CAS 1190989-09-3: 1-Methyl 4-borono-2,6-difluorobenzoate
Description:1-Methyl 4-borono-2,6-difluorobenzoate is an organic compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various chemical transformations, particularly in Suzuki coupling reactions. This compound features a methyl group and two fluorine atoms substituted on a benzene ring, contributing to its unique electronic properties and potential applications in medicinal chemistry and materials science. The presence of fluorine atoms typically enhances the compound's lipophilicity and metabolic stability, making it of interest in drug design. The boronic acid moiety allows for the formation of stable complexes with diols, which can be exploited in sensor technology and organic synthesis. Additionally, the compound's structure suggests it may exhibit interesting photophysical properties, which could be relevant in the development of fluorescent probes or materials. Overall, 1-Methyl 4-borono-2,6-difluorobenzoate is a versatile building block in organic synthesis with potential applications across various fields of chemistry.
Formula:C8H7BF2O4
InChI:InChI=1S/C8H7BF2O4/c1-15-8(12)7-5(10)2-4(9(13)14)3-6(7)11/h2-3,13-14H,1H3
InChI key:InChIKey=DFSQCSAZKURRRE-UHFFFAOYSA-N
SMILES:O=C(OC)C1=C(F)C=C(C=C1F)B(O)O
- Synonyms:
- [3,5-Difluoro-4-(methoxycarbonyl)phenyl]boronic acid
- 1-Methyl 4-borono-2,6-difluorobenzoate
- Benzoic acid, 4-borono-2,6-difluoro-, 1-methyl ester

Benzoic acid, 4-borono-2,6-difluoro-, 1-methyl ester
Ref: IN-DA000I6B
1g | 120.00 € | ||
5g | 295.00 € | ||
100mg | 56.00 € | ||
250mg | 71.00 € |

Ref: 54-PC901306
1g | 106.00 € | ||
5g | 326.00 € | ||
100mg | 57.00 € | ||
250mg | 92.00 € |

(3,5-Difluoro-4-(methoxycarbonyl)phenyl)boronic acid
Ref: 10-F437062
1g | 96.00 € | ||
5g | 273.00 € | ||
250mg | 46.00 € |

[3,5-difluoro-4-(methoxycarbonyl)phenyl]boronic Acid
Ref: 3D-FD105536
100mg | Discontinued | Request information |