CymitQuimica logo

CAS 1191-55-5

:

2-Propanol, 1-chloro-3-(dodecylamino)-

Description:
2-Propanol, 1-chloro-3-(dodecylamino)-, also known by its CAS number 1191-55-5, is an organic compound characterized by its structure, which includes a propanol backbone with a chlorine atom and a dodecylamino group. This compound typically exhibits properties associated with both alcohols and amines, such as moderate polarity and the ability to engage in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the dodecylamino group contributes to its hydrophobic characteristics, making it more soluble in non-polar solvents compared to water. This amphiphilic nature allows it to function effectively as a surfactant or emulsifier in various applications. Additionally, the chlorine substituent can influence its reactivity, potentially participating in nucleophilic substitution reactions. Safety data indicates that, like many chlorinated compounds, it may pose health risks, necessitating proper handling and storage protocols. Overall, 2-Propanol, 1-chloro-3-(dodecylamino)- is a versatile compound with applications in chemical synthesis and formulation chemistry.
Formula:C15H32ClNO
InChI:InChI=1S/C15H32ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-17-14-15(18)13-16/h15,17-18H,2-14H2,1H3
InChI key:InChIKey=QIQJKQRBYLSPDM-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)NCC(CCl)O
Synonyms:
  • 1-Chloro-3-(dodecylamino)propan-2-ol
  • 1-Chloro-3-(dodecylamino)-2-hydroxypropane
  • 2-Propanol, 1-chloro-3-(dodecylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.