CAS 1191028-50-8

6-Bromo-5-chloro-1H-indole

Description:

6-Bromo-5-chloro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and chlorine substituents at the 6 and 5 positions, respectively, contributes to its unique reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. The halogen substituents can influence the compound's electronic properties, stability, and reactivity, which are critical for its use in synthetic pathways or as a pharmacophore. Additionally, 6-Bromo-5-chloro-1H-indole may serve as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₈H₅BrClN

InChI: InChI=1S/C8H5BrClN/c9-6-4-8-5(1-2-11-8)3-7(6)10/h1-4,11H

SMILES: c1c[nH]c2cc(c(cc12)Cl)Br

Synonyms:

• 1H-Indole, 6-bromo-5-chloro-
• 6-Bromo-5-Chloroindole
• 6-Bromo-5-chloro-indole

1H-Indole, 6-bromo-5-chloro-

CAS: 1191028-50-8

Formula: C₈H₅BrClN

Purity: 96%

Color and Shape: Solid

Molecular weight: 230.4890

Ref: IN-DA000I6Y

6-Bromo-5-chloro-1H-indole

CAS: 1191028-50-8

6-Bromo-5-chloro-1H-indole

Purity: 96%

Molecular weight: 230.49g/mol

Ref: 54-OR81670

6-Bromo-5-chloro-1H-indole

CAS: 1191028-50-8

Formula: C₈H₅BrClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.49

Ref: 10-F214618