CymitQuimica logo

CAS 119103-16-1

:

1-Azabicyclo[2.2.1]heptane-4-carbonyl chloride

Description:
1-Azabicyclo[2.2.1]heptane-4-carbonyl chloride, with the CAS number 119103-16-1, is a bicyclic compound characterized by a nitrogen atom incorporated into a seven-membered ring structure. This compound features a carbonyl chloride functional group, which is indicative of its reactivity and potential use in organic synthesis. The bicyclic framework contributes to its unique steric and electronic properties, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the carbonyl chloride group suggests that it can participate in nucleophilic acyl substitution reactions, allowing for the introduction of diverse nucleophiles. Additionally, the nitrogen atom in the bicyclic structure may influence the compound's basicity and potential interactions with biological targets. Overall, 1-Azabicyclo[2.2.1]heptane-4-carbonyl chloride is notable for its structural complexity and reactivity, making it an interesting subject for further study in synthetic organic chemistry.
Formula:C7H10ClNO
InChI:InChI=1S/C7H10ClNO/c8-6(10)7-1-3-9(5-7)4-2-7/h1-5H2
InChI key:InChIKey=HCCVPYBRYJZKNL-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C12CN(CC1)CC2
Synonyms:
  • 1-Azabicyclo[2.2.1]heptane-4-carbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.