CAS 1191062-86-8
:1-Methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine
Description:
1-Methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine is a complex organic compound characterized by its unique structural features, including a piperazine ring and a pyridine moiety, which contribute to its potential biological activity. The presence of the dioxaborolane group suggests that it may participate in boron chemistry, potentially enhancing its reactivity or solubility in various environments. This compound is likely to exhibit properties such as moderate polarity due to the presence of nitrogen and boron atoms, which can influence its interaction with biological targets. Additionally, the methyl groups attached to the piperazine and pyridine rings may enhance lipophilicity, affecting its pharmacokinetics. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from medicinal chemistry to materials science, depending on its specific interactions and stability under various conditions. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C17H28BN3O2
InChI:InChI=1S/C17H28BN3O2/c1-13-11-14(18-22-16(2,3)17(4,5)23-18)12-19-15(13)21-9-7-20(6)8-10-21/h11-12H,7-10H2,1-6H3
InChI key:InChIKey=RAQYEPYXBNXWMA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C)C(=NC2)N3CCN(C)CC3
Synonyms:- 1-Methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine
- Piperazine, 1-methyl-4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Methyl-4-(3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine
CAS:Formula:C17H28BN3O2Molecular weight:317.2341
