CymitQuimica logo

CAS 1191062-88-0

:

1,2,3,4-Tetrahydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-naphthalenol

Description:
1,2,3,4-Tetrahydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-naphthalenol is a complex organic compound characterized by its unique structural features, including a naphthalene core and a dioxaborolane moiety. The presence of the tetrahydro group indicates that the compound has a saturated cyclic structure, contributing to its stability and potential reactivity. The dioxaborolane group is notable for its ability to participate in various chemical reactions, particularly in organoboron chemistry, making this compound potentially useful in synthetic applications. The compound's hydroxyl group (naphthalenol) suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. Additionally, the presence of multiple methyl groups enhances its steric bulk, which can affect its reactivity and interaction with biological systems. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable intermediate in organic synthesis and materials science.
Formula:C16H23BO3
InChI:InChI=1S/C16H23BO3/c1-15(2)16(3,4)20-17(19-15)13-7-5-12-10-14(18)8-6-11(12)9-13/h5,7,9,14,18H,6,8,10H2,1-4H3
InChI key:InChIKey=UTEARVMSBMCBJP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C3C(=CC2)CC(O)CC3
Synonyms:
  • 1,2,3,4-Tetrahydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-naphthalenol
  • 2-Naphthalenol, 1,2,3,4-tetrahydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.