
CAS 1191063-35-0
:3-Propyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole
Description:
3-Propyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole is an organic compound characterized by its unique structure, which includes an oxadiazole ring and a boron-containing moiety. The oxadiazole ring contributes to its potential as a heterocyclic compound, often associated with various biological activities and applications in materials science. The presence of the propyl group enhances its hydrophobic characteristics, while the tetramethyl-1,3,2-dioxaborolane unit introduces boron, which can facilitate coordination with other molecules and enhance electronic properties. This compound may exhibit interesting photophysical properties, making it suitable for applications in organic electronics, such as light-emitting diodes or sensors. Additionally, the specific arrangement of substituents can influence its reactivity and stability, which are critical for its performance in practical applications. Overall, this compound represents a class of materials that bridge organic chemistry and materials science, with potential uses in advanced technologies.
Formula:C17H23BN2O3
InChI:InChI=1S/C17H23BN2O3/c1-6-7-14-19-15(21-20-14)12-8-10-13(11-9-12)18-22-16(2,3)17(4,5)23-18/h8-11H,6-7H2,1-5H3
InChI key:InChIKey=UHNNKNVJFXGZGQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C=C2)C3=NC(CCC)=NO3
Synonyms:- 3-Propyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 3-propyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Propyl-5-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1,2,4-oxadiazole
CAS:Formula:C17H23BN2O3Molecular weight:314.1871
