
CAS 1191063-61-2
:B-(4-Butoxy-2-formylphenyl)boronic acid
Description:
B-(4-Butoxy-2-formylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with a butoxy group and a formyl group, which contribute to its reactivity and solubility properties. The boronic acid moiety allows for participation in cross-coupling reactions, making it valuable in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the butoxy group enhances its solubility in organic solvents, while the formyl group can serve as a reactive site for further functionalization. Overall, this compound exemplifies the versatility of boronic acids in synthetic organic chemistry, providing a platform for the construction of complex molecular architectures.
Formula:C11H15BO4
InChI:InChI=1S/C11H15BO4/c1-2-3-6-16-10-4-5-11(12(14)15)9(7-10)8-13/h4-5,7-8,14-15H,2-3,6H2,1H3
InChI key:InChIKey=HDEKORLJQNHWOH-UHFFFAOYSA-N
SMILES:C(=O)C1=C(B(O)O)C=CC(OCCCC)=C1
Synonyms:- B-(4-Butoxy-2-formylphenyl)boronic acid
- 4-Butoxy-2-formylphenylboronic acid
- Boronic acid, B-(4-butoxy-2-formylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
