CymitQuimica logo

CAS 1191063-86-1

:

3-Fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneethanamine

Description:
3-Fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneethanamine is a chemical compound characterized by its complex structure, which includes a fluorine atom, a methyl group, and a dioxaborolane moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The dioxaborolane group is known for its ability to participate in various chemical reactions, particularly in organoboron chemistry, making this compound potentially useful in synthetic applications. The amine functional group contributes to the compound's basicity and potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Overall, this compound's unique combination of functional groups suggests it may have applications in medicinal chemistry or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.
Formula:C15H23BFNO2
InChI:InChI=1S/C15H23BFNO2/c1-14(2)15(3,4)20-16(19-14)12-7-6-11(8-9-18-5)10-13(12)17/h6-7,10,18H,8-9H2,1-5H3
InChI key:InChIKey=YZELZUDPRAYMIV-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(CCNC)=C1
Synonyms:
  • Benzeneethanamine, 3-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-Fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzeneethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.