
CAS 1191287-92-9
:Ethoxylated pentaerythritol tetranorbornenecarboxylate
Description:
Ethoxylated pentaerythritol tetranorbornenecarboxylate is a chemical compound characterized by its complex structure, which includes ethoxylated groups and a tetranorbornenecarboxylate moiety. This substance typically exhibits properties such as being a viscous liquid or solid at room temperature, depending on its specific formulation and degree of ethoxylation. It is often used as a surfactant or emulsifier in various applications, including coatings, adhesives, and personal care products, due to its ability to enhance solubility and stability in formulations. The ethoxylation process imparts hydrophilic characteristics, making it effective in reducing surface tension and improving wetting properties. Additionally, the tetranorbornenecarboxylate structure contributes to its reactivity and compatibility with other chemical systems. Safety data sheets and regulatory information should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound plays a significant role in industrial applications, particularly in formulations requiring enhanced performance characteristics.
Formula:(C2H4O)n(C2H4O)n(C2H4O)n(C2H4O)nC37H44O8
Synonyms:- Poly(oxy-1,2-ethanediyl), α-hydro-ω-[(bicyclo[2.2.1]hept-5-en-2-ylcarbonyl)oxy]-, ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1)
- Ethoxylated pentaerythritol tetranorbornenecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Arm Poly(Ethylene Glycol)Norbornene Terminated
CAS:4-Arm Poly(Ethylene Glycol)Norbornene TerminatedPurity:average Mn 100004-Arm poly(ethylene glycol) norbornene terminated
CAS:Please enquire for more information about 4-Arm poly(ethylene glycol) norbornene terminated including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:(C8H9O2(C2H4O)nCH2)4CPurity:Min. 95%

