CAS 119160-36-0
:3-(1H-Indol-6-yl)-2-propenoic acid
Description:
3-(1H-Indol-6-yl)-2-propenoic acid, also known as indole-6-propenoic acid, is an organic compound characterized by its indole structure fused with a propenoic acid moiety. This compound features a double bond between the second and third carbon atoms of the propenoic acid, contributing to its reactivity and potential applications in organic synthesis. The indole ring, a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring, imparts unique electronic properties and biological activity. This substance is typically a solid at room temperature and is soluble in polar organic solvents. Its potential applications include use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its ability to participate in various chemical reactions, such as Michael additions and polymerizations. Additionally, compounds with indole structures are often studied for their biological activities, including anti-inflammatory and anticancer properties, making this compound of interest in medicinal chemistry.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c13-11(14)4-2-8-1-3-9-5-6-12-10(9)7-8/h1-7,12H,(H,13,14)
InChI key:InChIKey=ISFPWJSGXWEGPM-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C=1C=C2C(=CC1)C=CN2
Synonyms:- 3-(1H-Indol-6-yl)-2-propenoic acid
- 2-Propenoic acid, 3-(1H-indol-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
