CymitQuimica logo

CAS 119162-53-7

:

3-(4-Bromo-phenyl)isoxazol-5-ylamine

Description:
3-(4-Bromo-phenyl)isoxazol-5-ylamine is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromo substituent on the phenyl group enhances its reactivity and can influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. The amine functional group contributes to its basicity and potential for hydrogen bonding, which can affect its pharmacokinetic properties. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Its CAS number, 119162-53-7, serves as a unique identifier for regulatory and research purposes. Overall, this compound's structural features suggest potential applications in drug development and materials science.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,11H2
InChI key:RKWRDXQHQYRFCX-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=NOC(=C2)N)Br
Found 3 products.