CymitQuimica logo

CAS 119162-56-0

:

3-(2-Quinolinyl)-5-isoxazolamine

Description:
3-(2-Quinolinyl)-5-isoxazolamine is a chemical compound characterized by its unique structural features, which include a quinoline moiety and an isoxazole ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets due to its heterocyclic nature. Its molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or anti-inflammatory research. Additionally, the compound may undergo various chemical reactions, including substitution and cyclization, which can be exploited for further synthetic modifications. As with many heterocyclic compounds, the stability and reactivity can be influenced by the electronic properties of the substituents on the rings. Overall, 3-(2-Quinolinyl)-5-isoxazolamine represents a class of compounds that are valuable for exploring new therapeutic avenues in pharmaceutical research.
Formula:C12H9N3O
InChI:InChI=1S/C12H9N3O/c13-12-7-11(15-16-12)10-6-5-8-3-1-2-4-9(8)14-10/h1-7H,13H2
InChI key:InChIKey=RBPBZARVOWPZBS-UHFFFAOYSA-N
SMILES:NC1=CC(C2=NC3=C(C=C2)C=CC=C3)=NO1
Synonyms:
  • 3-(2-Quinolinyl)-5-isoxazolamine
  • 5-Isoxazolamine, 3-(2-quinolinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.