CAS 119170-51-3
:6-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
Description:
The chemical substance known as "6-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one," with the CAS number 119170-51-3, is a complex glycosylated flavonoid derivative. This compound features a naphthopyran backbone, which is characteristic of many flavonoids, contributing to its potential antioxidant properties. The presence of multiple sugar moieties, specifically a furanosyl and a glucopyranosyl unit, suggests that it may exhibit enhanced solubility and bioavailability compared to non-glycosylated flavonoids. The hydroxyl and methoxy groups on the naphthopyran structure can influence its reactivity and interaction with biological systems, potentially affecting its pharmacological activities. Such compounds are often studied for their therapeutic potential, including anti-inflammatory and anticancer properties. Additionally, the structural complexity may indicate a role in plant defense mechanisms or interactions with other biological molecules. Overall, this substance represents a fascinating area of research in natural products chemistry and pharmacognosy.
Formula:C26H30O14
InChI:InChI=1S/C26H30O14/c1-10-3-13(28)18-14(38-10)5-11-4-12(35-2)6-15(17(11)20(18)30)39-24-22(32)21(31)19(29)16(40-24)7-36-25-23(33)26(34,8-27)9-37-25/h3-6,16,19,21-25,27,29-34H,7-9H2,1-2H3/t16-,19-,21+,22-,23+,24-,25-,26-/m1/s1
InChI key:InChIKey=NIVCJAYDAMQSJO-PAMAHNMISA-N
SMILES:O(C=1C2=C(C=C3C(=C2O)C(=O)C=C(C)O3)C=C(OC)C1)[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@](CO)(O)CO5)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 4H-Naphtho[2,3-b]pyran-4-one, 6-[(6-O-<span class="text-smallcaps">D</smallcap>-apio-β-<smallcap>D</smallcap>-furanosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
- 6-[(6-O-<span class="text-smallcaps">D</smallcap>-Apio-β-<smallcap>D</smallcap>-furanosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- Cassiaside B
- CassiasideB
- Rubrofusarin-6-O-β-<span class="text-smallcaps">D</smallcap>-apiofuranosyl-(1→6)-O-β-<smallcap>D</span>-glucopyranoside
- 4H-Naphtho[2,3-b]pyran-4-one, 6-[(6-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
- 6-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- Rubrofusarin-6-O-β-D-apiofuranosyl-(1→6)-O-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cassiaside B
CAS:Cassiaside B is a natural product with potent antibacterial activity.Formula:C26H30O14Purity:99.82%Color and Shape:SolidMolecular weight:566.51Cassiaside B
CAS:Cassiaside B is a type of natural anthraquinone glycoside, derived primarily from the seeds of the Cassia genus, particularly Cassia tora and Cassia obtusifolia. These plants are well-recognized in traditional medicine systems for their therapeutic properties. The mode of action of Cassiaside B involves its role as a potent antioxidant, scavenging free radicals and reducing oxidative stress. Additionally, it exhibits anti-inflammatory effects by modulating specific pathways that are instrumental in the inflammatory response.
Formula:C26H30O14Purity:Min. 95%Molecular weight:566.50 g/molRef: 3D-UEA17051
Discontinued product



