CAS 119179-66-7
:6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin
Description:
6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin, with the CAS number 119179-66-7, is a synthetic organic compound belonging to the coumarin family, which is characterized by its benzopyrone structure. This compound features a chloro substituent at the 6-position and a hydroxy group at the 7-position, along with a trifluoromethyl group at the 4-position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. Coumarins are known for their diverse range of biological activities, including antimicrobial, anti-inflammatory, and anticoagulant properties. The specific structure of this compound may also impart fluorescence, making it useful in various applications such as fluorescence microscopy and as a fluorescent probe in biochemical assays. Additionally, the chlorine and trifluoromethyl groups can affect the compound's reactivity and stability, making it of interest in medicinal chemistry and material science. Overall, 6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin is a compound of significant interest for its potential applications in research and industry.
Formula:C10H4ClF3O3
InChI:InChI=1/C10H4ClF3O3/c11-6-1-4-5(10(12,13)14)2-9(16)17-8(4)3-7(6)15/h1-3,15H
SMILES:c1c2c(cc(=O)oc2cc(c1Cl)O)C(F)(F)F
Synonyms:- 6-Chloro-7-hydroxy-4-(trifluoromethyl)
- 6-chloro-7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-1-Benzopyran-2-one, 6-chloro-7-hydroxy-4-(trifluoromethyl)-
CAS:Formula:C10H4ClF3O3Purity:96%Color and Shape:SolidMolecular weight:264.58526-chloro-7-hydroxy-4-(trifluoromethyl)coumarin
CAS:6-chloro-7-hydroxy-4-(trifluoromethyl)coumarinPurity:97%Color and Shape:SolidMolecular weight:264.59g/mol6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin
CAS:Formula:C10H4ClF3O3Purity:95%Color and Shape:Solid, No data available.Molecular weight:264.586-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin
CAS:6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin is a fungicide that inhibits the growth of fungi by interfering with their DNA synthesis. It does this by inhibiting the activity of two enzymes: the fungal enzyme oxime and the enzyme cinerea, which is found in many fungi. 6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin has been shown to be effective against Alternaria and Botrytis cinerea. The compound also has an antifungal effect against other types of fungi, such as Penicillium roqueforti, when used in combination with a solvent such as ether.
Purity:Min. 95%Molecular weight:264.58 g/mol




