
CAS 119192-11-9
:4-(1H-1,2,4-Triazol-1-ylmethyl)phenol
Description:
4-(1H-1,2,4-Triazol-1-ylmethyl)phenol, identified by its CAS number 119192-11-9, is a chemical compound characterized by the presence of a phenolic group and a triazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, reactivity, and biological activity. The phenolic part contributes to its potential as an antioxidant, while the triazole ring may impart fungicidal or antimicrobial properties, making it of interest in pharmaceutical and agricultural applications. The compound's structure allows for hydrogen bonding due to the hydroxyl group, which can enhance its interactions with biological targets. Additionally, the presence of the triazole ring can facilitate coordination with metal ions, potentially leading to applications in coordination chemistry. Overall, 4-(1H-1,2,4-Triazol-1-ylmethyl)phenol is a versatile compound with potential utility in various fields, including medicinal chemistry and agrochemicals.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c13-9-3-1-8(2-4-9)5-12-7-10-6-11-12/h1-4,6-7,13H,5H2
InChI key:InChIKey=DHGHMNOUPYIXRU-UHFFFAOYSA-N
SMILES:C(C1=CC=C(O)C=C1)N2C=NC=N2
Synonyms:- Phenol, 4-(1H-1,2,4-triazol-1-ylmethyl)-
- 1-(4-Hydroxy-benzyl)-1,2,4-triazole
- STX 269
- 4-(1H-1,2,4-Triazol-1-ylmethyl)phenol
- 4-[([1,2,4]Triazol-1-yl)methyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

