CAS 119192-12-0
:4-(2H-Tetrazol-5-ylmethyl)phenol
Description:
4-(2H-Tetrazol-5-ylmethyl)phenol, identified by its CAS number 119192-12-0, is a chemical compound characterized by the presence of a phenolic group and a tetrazole moiety. The structure features a phenol ring substituted with a tetrazole group, which is a five-membered heterocyclic compound containing four nitrogen atoms and one carbon atom. This compound exhibits properties typical of both phenols and tetrazoles, including potential acidity due to the hydroxyl group and the ability to form hydrogen bonds. The tetrazole ring contributes to its stability and may enhance its reactivity in various chemical reactions, making it useful in medicinal chemistry and material science. Additionally, compounds with tetrazole groups are often explored for their biological activities, including antimicrobial and anti-inflammatory properties. The solubility and stability of 4-(2H-Tetrazol-5-ylmethyl)phenol can vary depending on the solvent and environmental conditions, which is important for its application in research and industry.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c13-7-3-1-6(2-4-7)5-8-9-11-12-10-8/h1-4,13H,5H2,(H,9,10,11,12)
InChI key:InChIKey=MEEDVZNIMBGRPZ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(O)C=C1)C=2NN=NN2
Synonyms:- Phenol, 4-(1H-tetrazol-5-ylmethyl)-
- Phenol, 4-(2H-tetrazol-5-ylmethyl)-
- 4-(2H-Tetrazol-5-ylmethyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
