
CAS 119198-95-7
:6,10b-Dihydro-2-methyl-5H-thiazolo[2,3-a]isoquinolin-3(2H)-one
Description:
6,10b-Dihydro-2-methyl-5H-thiazolo[2,3-a]isoquinolin-3(2H)-one is a heterocyclic compound characterized by its unique thiazole and isoquinoline structures. This compound features a fused ring system that contributes to its potential biological activity. The thiazole moiety introduces sulfur and nitrogen into the structure, which can enhance its reactivity and interaction with biological targets. The presence of a methyl group at the 2-position of the thiazole ring can influence its solubility and lipophilicity, potentially affecting its pharmacokinetic properties. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Additionally, the compound's CAS number, 119198-95-7, allows for easy identification and retrieval of information in chemical databases, facilitating research and development efforts in various scientific fields.
Formula:C12H13NOS
InChI:InChI=1S/C12H13NOS/c1-8-11(14)13-7-6-9-4-2-3-5-10(9)12(13)15-8/h2-5,8,12H,6-7H2,1H3
InChI key:InChIKey=SQVYWIFKAQIZFV-UHFFFAOYSA-N
SMILES:O=C1N2C(C=3C(CC2)=CC=CC3)SC1C
Synonyms:- 6,10b-Dihydro-2-methyl-5H-thiazolo[2,3-a]isoquinolin-3(2H)-one
- 5H-Thiazolo[2,3-a]isoquinolin-3(2H)-one, 6,10b-dihydro-2-methyl-
- 2-Methyl-6,10b-dihydro-5H-[1,3]thiazolo[2,3-a]isoquinolin-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5H-Thiazolo[2,3-a]isoquinolin-3(2H)-one, 6,10b-dihydro-2-methyl-
CAS:Formula:C12H13NOSMolecular weight:219.3027
