CymitQuimica logo

CAS 1192-18-3

:

cis-1,2-Dimethylcyclopentane

Description:
Cis-1,2-Dimethylcyclopentane is a cyclic hydrocarbon with the molecular formula C7H14. It features a cyclopentane ring with two methyl groups attached to adjacent carbon atoms in a cis configuration, which means the methyl groups are on the same side of the ring. This structural arrangement influences its physical and chemical properties, such as its boiling point, melting point, and density. The substance is a colorless liquid at room temperature and is relatively non-polar, making it soluble in organic solvents but not in water. Its molecular structure contributes to its relatively low reactivity under standard conditions, although it can undergo reactions typical of alkanes, such as combustion and halogenation. The cis configuration also affects its conformational stability and steric interactions, leading to distinct conformers. Due to its unique structure, cis-1,2-Dimethylcyclopentane is of interest in organic chemistry and may have applications in the synthesis of more complex molecules or as a solvent in various chemical reactions.
Formula:C7H14
InChI:InChI=1/C7H14/c1-6-4-3-5-7(6)2/h6-7H,3-5H2,1-2H3/t6-,7+
InChI key:InChIKey=RIRARCHMRDHZAR-KNVOCYPGNA-N
SMILES:C[C@H]1[C@@H](C)CCC1
Synonyms:
  • rel-(1R,2S)-1,2-Dimethylcyclopentane
  • Cyclopentane, 1,2-dimethyl-, (1R,2S)-rel-
  • Cyclopentane, 1,2-dimethyl-, cis-
  • cis-1,2-Dimethylcyclopentane
  • NSC 74146
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.