CAS 1192-20-7
:Homoserine lactone
Description:
Homoserine lactone, with the CAS number 1192-20-7, is a cyclic lactone derived from homoserine, an amino acid. It is characterized by its five-membered ring structure, which includes an ester functional group. This compound plays a significant role in bacterial communication, particularly in quorum sensing, where it acts as a signaling molecule. Homoserine lactone is typically colorless to pale yellow and is soluble in water and organic solvents, making it versatile in various chemical environments. Its reactivity is influenced by the presence of the lactone ring, which can undergo hydrolysis or react with nucleophiles. In biological systems, it is involved in regulating gene expression and coordinating group behaviors among bacterial populations. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, homoserine lactone is an important compound in microbiology and biochemistry, contributing to our understanding of microbial interactions and signaling pathways.
Formula:C4H7NO2
InChI:InChI=1S/C4H7NO2/c5-3-1-2-7-4(3)6/h3H,1-2,5H2
InChI key:InChIKey=QJPWUUJVYOJNMH-UHFFFAOYSA-N
SMILES:NC1C(=O)OCC1
Synonyms:- (±)-α-Amino-γ-butyrolactone
- 2(3H)-Furanone, 3-aminodihydro-
- 2-Aminobutyrolactone
- 3-Amino-2-tetrahydrofuranone
- 3-Amino-4,5-dihydrofuran-2(3H)-one
- 3-Aminodihydro-2(3H)-furanone
- 3-Aminooxolan-2-one
- 3-aminodihydrofuran-2(3H)-one
- 3-aminodihydrofuran-2(3H)-one hydrobromide (1:1)
- Butyric acid, 2-amino-4-hydroxy-, γ-lactone
- Homoserine Lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
