
CAS 1192-42-3
:Dihydro-3-hydroxy-3-methyl-2(3H)-furanone
Description:
Dihydro-3-hydroxy-3-methyl-2(3H)-furanone, also known as raspberry ketone, is an organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound typically appears as a colorless to pale yellow liquid with a sweet, fruity aroma reminiscent of raspberries, making it popular in the food and fragrance industries. It has a molecular formula that reflects its hydroxyl and methyl substituents, contributing to its unique properties. The compound is soluble in organic solvents and exhibits moderate stability under standard conditions. Its boiling point and melting point are influenced by the presence of functional groups, which also affect its reactivity. Dihydro-3-hydroxy-3-methyl-2(3H)-furanone is often studied for its potential applications in flavoring, fragrance, and even in some health-related contexts, although further research is necessary to fully understand its biological effects and safety profile. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C5H8O3
InChI:InChI=1S/C5H8O3/c1-5(7)2-3-8-4(5)6/h7H,2-3H2,1H3
InChI key:InChIKey=XVQNGICOIZBDTJ-UHFFFAOYSA-N
SMILES:CC1(O)C(=O)OCC1
Synonyms:- Butyric acid, 2,4-dihydroxy-2-methyl-, γ-lactone
- 2(3H)-Furanone, dihydro-3-hydroxy-3-methyl-
- Dihydro-3-hydroxy-3-methyl-2(3H)-furanone
- 3-Hydroxy-3-methyloxolan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
