
CAS 1192-59-2
:1-Ethenyl-4,5-dihydro-2-methyl-1H-imidazole
Description:
1-Ethenyl-4,5-dihydro-2-methyl-1H-imidazole, with the CAS number 1192-59-2, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a vinyl group (ethenyl) attached to the imidazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 2-position of the imidazole ring influences its physical and chemical properties, such as solubility and stability. Typically, compounds of this nature exhibit moderate polarity, making them soluble in polar organic solvents. They may participate in various chemical reactions, including polymerization and nucleophilic substitutions, due to the presence of the double bond and the nitrogen atoms, which can act as nucleophiles. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H10N2
InChI:InChI=1S/C6H10N2/c1-3-8-5-4-7-6(8)2/h3H,1,4-5H2,2H3
InChI key:InChIKey=VDSAXHBDVIUOGV-UHFFFAOYSA-N
SMILES:C(=C)N1C(C)=NCC1
Synonyms:- 2-Methyl-1-vinyl-4,5-dihydro-1H-imidazole
- 2-Imidazoline, 2-methyl-1-vinyl-
- 1-Ethenyl-4,5-dihydro-2-methyl-1H-imidazole
- 1H-Imidazole, 1-ethenyl-4,5-dihydro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
