CAS 1192-72-9
:4,5-DIMETHYL-1H-IMIDAZOLE-2-THIOL
Description:
4,5-Dimethyl-1H-imidazole-2-thiol, with the CAS number 1192-72-9, is an organic compound characterized by its imidazole ring structure, which contains two methyl groups at the 4 and 5 positions and a thiol (-SH) group at the 2 position. This compound is a derivative of imidazole, a five-membered heterocyclic compound containing nitrogen atoms. The presence of the thiol group imparts distinct chemical properties, including the ability to form disulfide bonds and participate in redox reactions. 4,5-Dimethyl-1H-imidazole-2-thiol is known for its potential applications in various fields, including biochemistry and pharmaceuticals, due to its reactivity and ability to act as a ligand in coordination chemistry. It may also exhibit biological activity, making it of interest in medicinal chemistry. The compound is typically handled with care due to the presence of the thiol group, which can be sensitive to oxidation and may have implications for stability and reactivity in different environments.
Formula:C5H8N2S
InChI:InChI=1/C5H8N2S/c1-3-4(2)7-5(8)6-3/h1-2H3,(H2,6,7,8)
SMILES:Cc1c(C)[nH]c(n1)S
Synonyms:- 2-Mercapto-4,5-Dimethylimidazole
- 4,5-Dimethylimidazole-2-Thiol
- 4,5-dimethyl-1,3-dihydro-2H-imidazole-2-thione
- 4,5-DIMETHYL-1H-IMIDAZOLE-2-THIOL
- 4,5-dimethyl-1,3-dihydroimidazole-2-thione
- 2H-Imidazole-2-thione, 1,3-dihydro-4,5-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5-Dimethyl-1H-imidazole-2-thiol
CAS:4,5-Dimethyl-1H-imidazole-2-thiolPurity:≥95%Molecular weight:128.20g/mol4,5-Dimethyl-1H-imidazole-2-thiol
CAS:Formula:C5H8N2SPurity:99.0%Color and Shape:SolidMolecular weight:128.194,5-Dimethyl-1H-imidazole-2-thiol
CAS:4,5-Dimethyl-1H-imidazole-2-thiol is a potential drug candidate for cancer therapy. It is an insulin-like growth factor (IGF) inhibitor that can be used to treat cancer. 4,5-Dimethyl-1H-imidazole-2-thiol has the ability to inhibit IGF receptors and reduce cell proliferation in tumor cells. This compound also has the ability to inhibit tyrosine kinase activity and disrupt IGF receptor autophosphorylation. The isoquinolinedione derivative of 4,5-dimethyl 1H imidazole 2 thiol has been shown to have increased potency as an inhibitor of IGF receptors and tyrosine kinase activity in vitro.
Formula:C5H8N2SPurity:Min. 95%Molecular weight:128.19 g/mol



