CAS 1192018-70-4

5-Butyl-2-(4-pyridinyl)benzoxazole

Description:

5-Butyl-2-(4-pyridinyl)benzoxazole is an organic compound characterized by its unique structure, which includes a benzoxazole ring fused with a pyridine moiety and a butyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents, which is influenced by the hydrophobic butyl group and the polar nature of the benzoxazole and pyridine functionalities. The presence of the pyridine ring may impart basicity and potential coordination chemistry, making it interesting for various applications in medicinal chemistry and materials science. Additionally, benzoxazole derivatives are known for their fluorescence properties, which can be utilized in sensing applications or as fluorescent probes. The compound may also exhibit biological activity, making it a candidate for further pharmacological studies. Its stability and reactivity can be influenced by the substituents on the aromatic rings, which can affect its interaction with biological targets or other chemical species. Overall, 5-Butyl-2-(4-pyridinyl)benzoxazole represents a versatile structure with potential applications in various fields of research.

Formula: C₁₆H₁₆N₂O

InChI: InChI=1S/C16H16N2O/c1-2-3-4-12-5-6-15-14(11-12)18-16(19-15)13-7-9-17-10-8-13/h5-11H,2-4H2,1H3

InChI key: InChIKey=YHDYMJGUDRQDQU-UHFFFAOYSA-N

SMILES: C(CCC)C=1C=C2C(OC(=N2)C=3C=CN=CC3)=CC1

Synonyms:

• 5-Butyl-2-(4-pyridinyl)benzoxazole
• Benzoxazole, 5-butyl-2-(4-pyridinyl)-

5-Butyl-2-(pyridin-4-yl)benzo[d]oxazole

CAS: 1192018-70-4

Formula: C₁₆H₁₆N₂O

Molecular weight: 252.3110

Ref: IN-DA000P6E