CAS 1192021-99-0

3-(Phenylmethoxy)-4-pyridinecarboxylic acid

Description:

3-(Phenylmethoxy)-4-pyridinecarboxylic acid, identified by its CAS number 1192021-99-0, is an organic compound characterized by its pyridine and carboxylic acid functional groups. This compound features a pyridine ring substituted at the 4-position with a carboxylic acid group and at the 3-position with a phenylmethoxy group, which contributes to its unique chemical properties. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The phenylmethoxy moiety enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature.

Formula: C₁₃H₁₁NO₃

InChI: InChI=1S/C13H11NO3/c15-13(16)11-6-7-14-8-12(11)17-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,15,16)

InChI key: InChIKey=YDSQPSGFEQHFHT-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C=2C(C(O)=O)=CC=NC2

Synonyms:

• 3-(Phenylmethoxy)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 3-(phenylmethoxy)-
• 3-Benzyloxy isonicotinic acid