
CAS 1192066-96-8
:1-Amino-3-methoxycyclohexanecarboxylic acid
Description:
1-Amino-3-methoxycyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure, which is substituted with an amino group, a methoxy group, and a carboxylic acid functional group. This compound features a chiral center, leading to potential stereoisomerism. The presence of the amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties, making it a zwitterionic species in certain pH conditions. The methoxy group enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the context of amino acid derivatives. Its structural features suggest possible applications in medicinal chemistry, where modifications to the cyclohexane framework could lead to novel therapeutic agents. Overall, 1-Amino-3-methoxycyclohexanecarboxylic acid exemplifies the complexity and versatility of amino acid derivatives in organic synthesis and drug development.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-12-6-3-2-4-8(9,5-6)7(10)11/h6H,2-5,9H2,1H3,(H,10,11)
InChI key:InChIKey=WQNHZQUUYOHMKL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)CC(OC)CCC1
Synonyms:- 1-Amino-3-methoxycyclohexane-1-carboxylic acid
- 1-Amino-3-methoxycyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 1-amino-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.