CAS 119209-27-7

2-[[[(3,5-Dichlorophenyl)amino]carbonyl]oxy]-2-methyl-3-butenoic acid

Description:

2-[[[(3,5-Dichlorophenyl)amino]carbonyl]oxy]-2-methyl-3-butenoic acid, identified by its CAS number 119209-27-7, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group, an amino group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various solvents. The presence of the dichlorophenyl moiety suggests that it may possess significant biological activity, potentially acting as an inhibitor or modulator in biochemical pathways. Additionally, the carboxylic acid group indicates acidic properties, which can influence its behavior in different pH environments. The compound's structural features may also allow for interactions with biological targets, making it of interest in pharmaceutical research. Overall, its unique combination of functional groups and structural characteristics positions it as a compound of interest in medicinal chemistry and related fields.

Formula: C₁₂H₁₁Cl₂NO₄

InChI: InChI=1S/C12H11Cl2NO4/c1-3-12(2,10(16)17)19-11(18)15-9-5-7(13)4-8(14)6-9/h3-6H,1H2,2H3,(H,15,18)(H,16,17)

InChI key: InChIKey=KTXGWKXVQGCPAR-UHFFFAOYSA-N

SMILES: C(OC(NC1=CC(Cl)=CC(Cl)=C1)=O)(C(O)=O)(C=C)C

Synonyms:

• 3-Butenoic acid, 2-[[[(3,5-dichlorophenyl)amino]carbonyl]oxy]-2-methyl-
• 2-[[[(3,5-Dichlorophenyl)amino]carbonyl]oxy]-2-methyl-3-butenoic acid
• 2-[(3,5-Dichlorophenyl)carbamoyloxy]-2-methylbut-3-enoic acid
• M 1

3-Butenoic acid, 2-[[[(3,5-dichlorophenyl)amino]carbonyl]oxy]-2-methyl-

CAS: 119209-27-7

Formula: C₁₂H₁₁Cl₂NO₄

Molecular weight: 304.126

Ref: IN-DA000IE3