CAS 1192150-16-5

6-Ethoxy-4(3H)-pteridinone

Description:

6-Ethoxy-4(3H)-pteridinone is a chemical compound characterized by its pteridinone core structure, which is a bicyclic compound containing a fused pyrimidine and pyrazine ring. This compound features an ethoxy group at the 6-position, which contributes to its solubility and reactivity. The presence of the pteridinone moiety suggests potential biological activity, as pteridines are known to play roles in various biochemical processes, including those related to folate metabolism and enzyme function. The compound may exhibit properties such as fluorescence or UV absorbance due to its conjugated system, making it of interest in both medicinal chemistry and analytical applications. Its CAS number, 1192150-16-5, allows for precise identification in chemical databases. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent choice, temperature, and the presence of other reagents. Further studies would be necessary to fully elucidate its properties and potential uses in research or industry.

Formula: C₈H₈N₄O₂

InChI: InChI=1S/C8H8N4O2/c1-2-14-5-3-9-7-6(12-5)8(13)11-4-10-7/h3-4H,2H2,1H3,(H,9,10,11,13)

InChI key: InChIKey=DJPBBZAAKRTUER-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC=C(OCC)N2)=NC=N1

Synonyms:

• 6-Ethoxy-4(3H)-pteridinone
• 4(3H)-Pteridinone, 6-ethoxy-