
CAS 1192150-20-1
:4-Chloro-6-ethoxypteridine
Description:
4-Chloro-6-ethoxypteridine is a heterocyclic organic compound characterized by its pyridine ring structure, which includes a chlorine atom and an ethoxy group at specific positions. The presence of the chlorine atom at the 4-position and the ethoxy group at the 6-position contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The chlorine substituent can enhance the compound's electrophilic character, while the ethoxy group may provide steric hindrance or alter its lipophilicity. As with many halogenated compounds, safety precautions should be taken due to potential toxicity or environmental impact. Overall, 4-Chloro-6-ethoxypteridine is of interest in various chemical research fields, particularly in the development of new materials or biologically active compounds.
Formula:C8H7ClN4O
InChI:InChI=1S/C8H7ClN4O/c1-2-14-5-3-10-8-6(13-5)7(9)11-4-12-8/h3-4H,2H2,1H3
InChI key:InChIKey=VNYIXFGRWSHNSB-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC(OCC)=N2)N=CN1
Synonyms:- 4-Chloro-6-ethoxypteridine
- Pteridine, 4-chloro-6-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.