CAS 1192263-84-5

3,4-Dinitrosobenzonitrile

Description:

3,4-Dinitrosobenzonitrile is an organic compound characterized by the presence of two nitro groups (-NO2) attached to a benzene ring that also features a nitrile group (-CN). This compound is typically represented by its molecular formula, which reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms. The nitro groups contribute to its reactivity and potential applications in various chemical processes, including as a precursor in organic synthesis. The nitrile group imparts additional properties, such as increased polarity and potential for hydrogen bonding. 3,4-Dinitrosobenzonitrile is often studied for its role in the development of dyes, pharmaceuticals, and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many nitro compounds, it may exhibit explosive characteristics under certain conditions, necessitating careful handling and storage. Overall, 3,4-Dinitrosobenzonitrile is a significant compound in the field of organic chemistry, with diverse applications and implications for research and industry.

Formula: C₇H₃N₃O₂

InChI: InChI=1S/C7H3N3O2/c8-4-5-1-2-6(9-11)7(3-5)10-12/h1-3H

InChI key: InChIKey=LADGBQYIOVAFJN-UHFFFAOYSA-N

SMILES: N(=O)C1=C(N=O)C=CC(C#N)=C1

Synonyms:

• 3,4-Dinitrosobenzonitrile
• Benzonitrile, 3,4-dinitroso-