
CAS 1192263-91-4
:4-[[Bis(phenylmethyl)amino]methyl]-4-piperidinol
Description:
4-[[Bis(phenylmethyl)amino]methyl]-4-piperidinol, identified by its CAS number 1192263-91-4, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) at the 4-position of the piperidine ring, contributing to its potential as a secondary amine. The presence of two phenylmethyl groups attached to the nitrogen atom enhances its lipophilicity, which may influence its solubility and biological activity. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of piperidine derivatives to interact with various biological targets. Additionally, the compound may exhibit interesting properties such as hydrogen bonding capabilities due to the hydroxyl group, which can affect its reactivity and interactions in different environments. Overall, this compound's unique structural features make it a subject of interest for further research in chemical and pharmaceutical applications.
Formula:C20H26N2O
InChI:InChI=1S/C20H26N2O/c23-20(11-13-21-14-12-20)17-22(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-10,21,23H,11-17H2
InChI key:InChIKey=PIPXDBRSAWZSQW-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)CC2=CC=CC=C2)C3(O)CCNCC3
Synonyms:- 4-Piperidinol, 4-[[bis(phenylmethyl)amino]methyl]-
- 4-[[Bis(phenylmethyl)amino]methyl]-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.