CAS 1192263-94-7
:Methyl 3,6-dibromo-2-hydroxy-1-naphthalenecarboxylate
Description:
Methyl 3,6-dibromo-2-hydroxy-1-naphthalenecarboxylate is an organic compound characterized by its naphthalene backbone, which is substituted with two bromine atoms at the 3 and 6 positions, a hydroxyl group at the 2 position, and a carboxylate ester functional group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents due to its hydrophobic naphthalene structure, while the hydroxyl group can impart some degree of polarity. The presence of bromine atoms suggests that it may exhibit interesting reactivity, particularly in electrophilic substitution reactions or as a potential precursor in synthetic organic chemistry. The hydroxyl group also indicates potential for hydrogen bonding, which can influence its physical properties, such as melting point and solubility. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the biological activity often associated with brominated naphthalene derivatives. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can pose environmental and health risks.
Formula:C12H8Br2O3
InChI:InChI=1S/C12H8Br2O3/c1-17-12(16)10-8-3-2-7(13)4-6(8)5-9(14)11(10)15/h2-5,15H,1H3
InChI key:InChIKey=JNSBMLKNHKAHHS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(C=C(Br)C1O)C=C(Br)C=C2
Synonyms:- Methyl 3,6-dibromo-2-hydroxy-1-naphthalenecarboxylate
- 1-Naphthalenecarboxylic acid, 3,6-dibromo-2-hydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.