CAS 119229-65-1

HP 184

Description:

HP 184, with the CAS number 119229-65-1, is a chemical compound that belongs to the class of phosphonates. It is primarily recognized for its application as a flame retardant and is often utilized in various polymer formulations to enhance fire resistance. The compound exhibits characteristics typical of organophosphorus compounds, including the ability to form stable complexes with metal ions, which can influence its reactivity and stability. HP 184 is generally considered to have low volatility, making it suitable for use in high-temperature applications. Additionally, it is known for its compatibility with a range of polymers, which allows for effective incorporation into different materials without significantly altering their physical properties. Safety assessments indicate that HP 184 has a low toxicity profile, although, like many chemical substances, it should be handled with care to avoid potential environmental impacts. Overall, HP 184 serves as an important additive in materials science, particularly in enhancing the safety and performance of various products.

Formula: C₁₇H₁₈FN₃

InChI: InChI=1/C17H18FN3/c1-3-10-20(17-8-9-19-11-15(17)18)21-12-13(2)14-6-4-5-7-16(14)21/h4-9,11-12H,3,10H2,1-2H3

SMILES: CCCN(c1ccncc1F)n1cc(C)c2ccccc12

Synonyms:

• Nerispirdine
• N-(3-fluoro-4-pyridyl)-3-methyl-N-propyl-indol-1-amine

Nerispirdine

CAS: 119229-65-1

Nerispirdine is a biochemical that inhibits batrachotoxin binding to voltage-dependent sodium channels.

Formula: C₁₇H₁₈FN₃

Color and Shape: Solid

Molecular weight: 283.34

Ref: TM-T71281