
CAS 1192356-23-2
:α,α-Dimethyl-6-(trifluoromethyl)-2-pyridinemethanol
Description:
α,α-Dimethyl-6-(trifluoromethyl)-2-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2-position with a hydroxymethyl group and at the 6-position with a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences the compound's electronic properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The two methyl groups at the α-position contribute to steric hindrance, which can impact the compound's interactions with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for various applications in medicinal chemistry. Its solubility and stability in different solvents can vary, influenced by the functional groups present. As with many fluorinated compounds, it may also exhibit unique characteristics in terms of volatility and environmental persistence. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H10F3NO
InChI:InChI=1S/C9H10F3NO/c1-8(2,14)6-4-3-5-7(13-6)9(10,11)12/h3-5,14H,1-2H3
InChI key:InChIKey=APJOFHZRFJXSRS-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C=1N=C(C(F)(F)F)C=CC1
Synonyms:- 2-Pyridinemethanol, α,α-dimethyl-6-(trifluoromethyl)-
- 2-[6-(Trifluoromethyl)pyridin-2-yl]propan-2-ol
- 2-(6-Trifluoromethyl-pyridin-2-yl)-propan-2-ol
- α,α-Dimethyl-6-(trifluoromethyl)-2-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.