CymitQuimica logo

CAS 1192488-87-1

:

4,4,5,5-Tetramethyl-2-[(1Z)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-[(1Z)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound typically exhibits a high degree of stability due to the presence of the boron atom, which can participate in various chemical reactions, including cross-coupling reactions that are valuable in organic synthesis. The presence of the tetramethyl and 4-methylphenyl substituents contributes to its lipophilicity and may influence its solubility in organic solvents. Additionally, the (1Z)-configuration of the ethenyl group indicates a specific geometric arrangement that can affect the compound's reactivity and interaction with other molecules. This compound may be utilized in the development of pharmaceuticals, agrochemicals, or as a reagent in synthetic organic chemistry, owing to the versatile nature of boron-containing compounds in forming new carbon-carbon bonds. Its specific applications would depend on further studies regarding its reactivity and biological properties.
Formula:C15H21BO2
InChI:InChI=1S/C15H21BO2/c1-12-6-8-13(9-7-12)10-11-16-17-14(2,3)15(4,5)18-16/h6-11H,1-5H3/b11-10-
InChI key:InChIKey=HHBWKASJNTZJLB-KHPPLWFESA-N
SMILES:C(=C\C1=CC=C(C)C=C1)\B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1Z)-2-(4-methylphenyl)ethenyl]-
  • 4,4,5,5-Tetramethyl-2-[(1Z)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.