CymitQuimica logo

CAS 1192548-10-9

:

4,4,5,5-Tetramethyl-2-[3-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-[3-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane is an organoboron compound characterized by its unique structural features, including a dioxaborolane ring and a nitro-substituted trifluoromethylphenyl group. This compound typically exhibits a high degree of stability due to the presence of the boron atom, which can participate in various chemical reactions, particularly in organic synthesis and catalysis. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The nitro group may impart additional electronic effects, making the compound potentially useful in applications such as pharmaceuticals or agrochemicals. Its solubility properties can vary depending on the solvent, and it may exhibit interesting optical or electronic properties due to its molecular structure. Overall, this compound is of interest in the fields of synthetic organic chemistry and materials science, particularly for its potential applications in drug development and as a building block in complex organic molecules.
Formula:C13H15BF3NO4
InChI:InChI=1S/C13H15BF3NO4/c1-11(2)12(3,4)22-14(21-11)8-6-5-7-9(18(19)20)10(8)13(15,16)17/h5-7H,1-4H3
InChI key:InChIKey=IWPFZQHULSXCKS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1N(=O)=O)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 4,4,5,5-Tetramethyl-2-[3-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-nitro-2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.