CAS 119259-72-2
:glidobactin F
Description:
Glidobactin F is a natural product belonging to the class of compounds known as antibiotics, specifically derived from the bacterium *Glidobacte* species. It exhibits notable antibacterial properties, making it of interest in pharmaceutical research. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Glidobactin F has been studied for its mechanism of action, which typically involves interference with bacterial cell wall synthesis or other critical cellular processes. Its efficacy against various bacterial strains highlights its potential as a therapeutic agent. Additionally, research into glidobactin F may reveal insights into its pharmacokinetics, toxicity, and potential applications in treating bacterial infections. As with many natural antibiotics, the exploration of glidobactin F also raises questions about resistance mechanisms and the importance of sustainable sourcing from natural environments. Overall, glidobactin F represents a significant area of study within the field of medicinal chemistry and antibiotic development.
Formula:C25H40N4O6
InChI:InChI=1/C25H40N4O6/c1-4-5-6-7-8-9-10-11-22(33)29-23(18(3)30)25(35)28-20-16-19(31)14-15-26-21(32)13-12-17(2)27-24(20)34/h8-13,17-20,23,30-31H,4-7,14-16H2,1-3H3,(H,26,32)(H,27,34)(H,28,35)(H,29,33)/b9-8+,11-10+,13-12-/t17-,18+,19-,20-,23-/m0/s1
Synonyms:- 2,4-Decadienamide, N-(2-hydroxy-1-(((10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl)amino)carbonyl)propyl)-, (5S-(3E,5R*,8R*(1R*(2E,4E),2S*),10R*))-
- Bu-2867TF
- 2,4-Decadienamide, N-[(1S,2R)-2-hydroxy-1-[[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]carbonyl]propyl]-, (2E,4E)- (9CI)
- glidobactin F
- (2E,4E)-N-[(1S,2R)-2-Hydroxy-1-[[[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3-en]-8-yl]amino]carbonyl]propyl]-2,4-decadienamide
- (2E,4E)-N-[(1S,2R)-2-hydroxy-1-{[(3Z,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]carbamoyl}propyl]deca-2,4-dienamide
- Glidobactin F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glidobactin F
CAS:Glidobactin F is an antitumor antibiotic effective against pathogenic fungi and yeasts. It has been shown to increase the survival time of mice inoculated with leukemia P388 cells.Formula:C25H40N4O6Color and Shape:SolidMolecular weight:492.608
