CAS 119264-56-1
:2,2',3,4,4',6,6'-heptabromobiphenyl
Description:
2,2',3,4,4',6,6'-heptabromobiphenyl, with CAS number 119264-56-1, is a polybrominated biphenyl (PBB) compound characterized by the presence of seven bromine atoms attached to a biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are used to reduce flammability in various materials. Its molecular structure contributes to its stability and resistance to degradation, making it persistent in the environment. 2,2',3,4,4',6,6'-heptabromobiphenyl is typically a solid at room temperature and is insoluble in water, but may dissolve in organic solvents. Due to its brominated nature, it exhibits potential toxicity and environmental concerns, particularly regarding bioaccumulation and endocrine disruption. Regulatory scrutiny has increased over the use of such compounds, leading to restrictions in many regions. Safety measures are essential when handling this substance, as it may pose health risks through exposure. Overall, while it serves a functional purpose in fire safety, its environmental and health implications warrant careful consideration.
Formula:C12H3Br7
InChI:InChI=1/C12H3Br7/c13-4-1-5(14)9(6(15)2-4)10-7(16)3-8(17)11(18)12(10)19/h1-3H
Synonyms:- 2,2',3,4,4',6,6'-Heptabromo-1,1'-biphenyl
- 1,1'-Biphenyl, 2,2',3,4,4',6,6'-heptabromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
