CAS 119264-60-7
:2,23,34,5,6,6Octabromobiphenyl
Description:
2,2',3,3',4,4',5,5'-Octabromobiphenyl, with the CAS number 119264-60-7, is a polybrominated biphenyl (PBB) compound characterized by the presence of eight bromine atoms attached to a biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are used to reduce the flammability of materials. Its molecular structure contributes to its stability and resistance to degradation, making it persistent in the environment. Octabromobiphenyl is typically a white to off-white solid and is insoluble in water but soluble in organic solvents. Due to its brominated nature, it exhibits significant hydrophobicity and lipophilicity. While it is effective as a flame retardant, concerns have been raised regarding its environmental impact and potential health effects, as it can bioaccumulate and may disrupt endocrine functions. Regulatory measures in various regions have led to restrictions on its use, prompting research into safer alternatives.
Formula:C12H2Br8
InChI:InChI=1/C12H2Br8/c13-3-1-6(16)11(19)12(20)7(3)8-9(17)4(14)2-5(15)10(8)18/h1-2H
SMILES:c1c(c(c2c(c(cc(c2Br)Br)Br)Br)c(c(c1Br)Br)Br)Br
Synonyms:- 2,2',3,3',4,5,6,6'-Octabromobiphenyl,35 ug/mL in isooctane
- 2,2',3,3',4,5',6,6'-Octabromobiphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
