CAS 119264-63-0
:2,2',3,3',4,5,5',6,6'-nonabromobiphenyl
Description:
2,2',3,3',4,5,5',6,6'-nonabromobiphenyl is a polybrominated biphenyl (PBB) compound characterized by the presence of nine bromine atoms attached to a biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are used to reduce flammability in various materials. Its molecular structure consists of two phenyl rings connected by a single bond, with bromine substituents at multiple positions, significantly altering its physical and chemical properties. Nonabromobiphenyl is typically a solid at room temperature and is insoluble in water but soluble in organic solvents. Due to its high bromine content, it exhibits excellent flame-retardant properties. However, like other PBBs, it raises environmental and health concerns due to its persistence, potential bioaccumulation, and toxicity. Regulatory measures have been implemented in many regions to limit its use and release into the environment, reflecting growing awareness of the risks associated with brominated compounds.
Formula:C12HBr9
InChI:InChI=1/C12HBr9/c13-2-1-3(14)7(16)4(6(2)15)5-8(17)10(19)12(21)11(20)9(5)18/h1H
SMILES:c1c(c(c(c2c(c(c(c(c2Br)Br)Br)Br)Br)c(c1Br)Br)Br)Br
Synonyms:- 1,1'-Biphenyl, 2,2',3,3',4,5,5',6,6'-nonabromo-
- 2,2',3,3',4,5,5',6,6'-Nonabromo-1,1'-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
