CAS 1192813-46-9

2-(1H-Imidazol-5-yl)-1,4-benzenediol

Description:

2-(1H-Imidazol-5-yl)-1,4-benzenediol, identified by its CAS number 1192813-46-9, is an organic compound featuring both an imidazole and a dihydroxybenzene moiety. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals and materials science due to its unique structural features. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in various biological systems and can act as ligands in coordination chemistry. The dihydroxybenzene part of the molecule may contribute to its reactivity and ability to form hydrogen bonds, enhancing its solubility in polar solvents. Additionally, the compound may exhibit antioxidant properties, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, this compound represents a fascinating intersection of organic chemistry and potential biological applications.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c12-6-1-2-9(13)7(3-6)8-4-10-5-11-8/h1-5,12-13H,(H,10,11)

InChI key: InChIKey=IMOBQVURAKZZKM-UHFFFAOYSA-N

SMILES: OC1=C(C=C(O)C=C1)C2=CN=CN2

Synonyms:

• 2-(1H-Imidazol-5-yl)-1,4-benzenediol
• 1,4-Benzenediol, 2-(1H-imidazol-5-yl)-
• 2-(1H-Imidazol-4-yl)benzene-1,4-diol