CymitQuimica logo

CAS 1192813-83-4

:

5-(Cyclopentyloxy)-2-pyrimidinamine

Description:
5-(Cyclopentyloxy)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a cyclopentyloxy group at the 5-position of the pyrimidine enhances its lipophilicity and may influence its biological activity. This compound is typically classified as an amine due to the amino group (-NH2) located at the 2-position of the pyrimidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and the ability to form hydrogen bonds due to the amino group. As with many pyrimidine derivatives, it may also participate in various chemical reactions, including alkylation and acylation, making it a versatile building block in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-9-11-5-8(6-12-9)13-7-3-1-2-4-7/h5-7H,1-4H2,(H2,10,11,12)
InChI key:InChIKey=XGAKNUPZXKPFOS-UHFFFAOYSA-N
SMILES:O(C=1C=NC(N)=NC1)C2CCCC2
Synonyms:
  • 2-Pyrimidinamine, 5-(cyclopentyloxy)-
  • 5-(Cyclopentyloxy)-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.