
CAS 1192813-91-4
:5-Bromo-4-(1-methylethyl)-2-pyrimidinamine
Description:
5-Bromo-4-(1-methylethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and an isopropyl group at the 4-position contributes to its unique properties. This compound is typically classified as an amine due to the amino group (-NH2) attached to the pyrimidine ring, which can influence its reactivity and solubility. It may exhibit biological activity, making it of interest in pharmaceutical research. The bromine substituent can enhance the compound's lipophilicity, potentially affecting its interaction with biological targets. Additionally, the isopropyl group can provide steric hindrance, influencing the compound's overall reactivity and stability. As with many pyrimidine derivatives, this compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry and medicinal chemistry applications.
Formula:C7H10BrN3
InChI:InChI=1S/C7H10BrN3/c1-4(2)6-5(8)3-10-7(9)11-6/h3-4H,1-2H3,(H2,9,10,11)
InChI key:InChIKey=GSCRYWWEBZTTBF-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C(Br)=CN=C(N)N1
Synonyms:- 5-Bromo-4-isopropylpyrimidin-2-amine
- 5-Bromo-4-(1-methylethyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 5-bromo-4-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.