CymitQuimica logo

CAS 1192813-96-9

:

6-(Cyclopentyloxy)-4-pyrimidinamine

Description:
6-(Cyclopentyloxy)-4-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopentyloxy group at the 6-position enhances its lipophilicity, potentially influencing its biological activity and solubility properties. This compound may exhibit properties typical of pyrimidine derivatives, such as involvement in biological processes or potential as a pharmaceutical agent. Its amine functional group at the 4-position can participate in hydrogen bonding, making it a candidate for interactions with various biological targets. The molecular structure suggests that it may be of interest in medicinal chemistry, particularly in the development of compounds with specific pharmacological effects. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and materials science.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-8-5-9(12-6-11-8)13-7-3-1-2-4-7/h5-7H,1-4H2,(H2,10,11,12)
InChI key:InChIKey=IVIXRMWFVKQEBE-UHFFFAOYSA-N
SMILES:O(C=1C=C(N)N=CN1)C2CCCC2
Synonyms:
  • 6-(Cyclopentyloxy)-4-pyrimidinamine
  • 6-(Cyclopentyloxy)pyrimidin-4-amine
  • 4-Pyrimidinamine, 6-(cyclopentyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.