CAS 119284-05-8
:N-(3,5-difluorophenyl)-2-pyridinecarbothioamide
Description:
N-(3,5-difluorophenyl)-2-pyridinecarbothioamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a thioamide functional group. The presence of the difluorophenyl moiety contributes to its potential reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The thioamide group can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the difluorophenyl substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Such characteristics make it of interest in medicinal chemistry and material science, where it may serve as a lead compound for drug development or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H8F2N2S
InChI:InChI=1/C12H8F2N2S/c13-8-5-9(14)7-10(6-8)16-12(17)11-3-1-2-4-15-11/h1-7H,(H,16,17)
SMILES:c1ccnc(c1)C(=Nc1cc(cc(c1)F)F)S
Synonyms:- Ay 31574
- 2-Pyridinecarbothioamide, N-(3,5-difluorophenyl)-
- N-(3,5-difluorophenyl)pyridine-2-carbothioamide
- N-(3,5-Difluorophenyl)-2-pyridinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
