CAS 119290-24-3
:2-amino-5-ethylidene-1-methylimidazol-4-one
Description:
2-Amino-5-ethylidene-1-methylimidazol-4-one is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing nitrogen atoms. This compound features an amino group (-NH2) and an ethylidene group, contributing to its reactivity and potential biological activity. The presence of the methyl group at the 1-position of the imidazole ring influences its solubility and stability. Typically, compounds of this nature may exhibit properties such as being polar, which can affect their interaction with biological systems and solvents. The imidazole moiety is known for its role in various biochemical processes, including enzyme catalysis and as a building block in pharmaceuticals. Additionally, the compound may participate in hydrogen bonding due to its functional groups, which can further influence its physical and chemical properties. Overall, 2-amino-5-ethylidene-1-methylimidazol-4-one is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.
Formula:C6H9N3O
InChI:InChI=1/C6H9N3O/c1-3-4-5(10)8-6(7)9(4)2/h3H,1-2H3,(H2,7,8,10)/b4-3-
Synonyms:- AEMI
- (5Z)-2-amino-5-ethylidene-1-methyl-1,5-dihydro-4H-imidazol-4-one
- 4H-Imidazol-4-one, 2-amino-5-ethylidene-1,5-dihydro-1-methyl-
- 2-Amino-5-ethylidene-1-methylimidazol-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4H-Imidazol-4-one, 2-amino-5-ethylidene-1,5-dihydro-1-methyl-
CAS:Formula:C6H9N3OMolecular weight:139.1552
