CymitQuimica logo

CAS 119290-87-8

:

Acanthoic acid

Description:
Acanthoic acid, with the CAS number 119290-87-8, is a naturally occurring fatty acid derived from certain species of plants, particularly those in the Acanthaceae family. It is characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. Acanthoic acid typically exhibits a range of biological activities, including potential antimicrobial and anti-inflammatory effects, which have garnered interest in pharmaceutical and nutraceutical applications. The compound's structure includes a carboxylic acid functional group, which is responsible for its acidic properties. Additionally, it may participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Its unique properties and potential health benefits continue to be the subject of research, particularly in the context of natural product chemistry and medicinal applications.
Formula:C20H30O2
InChI:InChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,9,14,16H,1,6-8,10-13H2,2-4H3,(H,21,22)/t14-,16-,18-,19-,20+/m0/s1
InChI key:InChIKey=TVHDZSRRHQKNEZ-MGFONVBGSA-N
SMILES:C[C@]12[C@@]([C@@](C(O)=O)(C)CCC1)(CC[C@@]3(C2=CC[C@@](C=C)(C)C3)[H])[H]
Synonyms:
  • 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,6,7,8,8a,9,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,7S,8aS,10aS)-
  • 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,6,7,8,8a,9,10,10a-dodecahydro-1,4a,7-trimethyl-, [1R-(1α,4aα,7α,8aβ,10aβ)]-
  • (1R,4aR,7S,8aS,10aS)-7-Ethenyl-1,2,3,4,4a,6,7,8,8a,9,10,10a-dodecahydro-1,4a,7-trimethyl-1-phenanthrenecarboxylic acid
  • Acanthoic acid
  • (-)-Acanthoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.