
CAS 1193-17-5
:rel-(1R,3R)-3-Methylcyclohexanamine
Description:
Rel-(1R,3R)-3-Methylcyclohexanamine, with the CAS number 1193-17-5, is an organic compound characterized by its cyclohexane structure, which features a methyl group and an amine functional group. This compound is a chiral amine, meaning it has two enantiomers due to the presence of a stereocenter at the carbon atom adjacent to the amine group. The specific configuration (1R,3R) indicates the spatial arrangement of the substituents around the chiral centers, which can influence its biological activity and interactions. Typically, such compounds are studied for their potential applications in pharmaceuticals, particularly as intermediates in the synthesis of various bioactive molecules. The presence of the amine group suggests that it may participate in hydrogen bonding, affecting its solubility and reactivity. Additionally, the methyl group can influence steric hindrance and electronic properties, which are crucial for its behavior in chemical reactions and interactions with biological systems. Overall, rel-(1R,3R)-3-Methylcyclohexanamine is of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H15N
InChI:InChI=1/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3/t6-,7-/s2
InChI key:InChIKey=JYDYHSHPBDZRPU-WZTWBHKBNA-N
SMILES:C[C@H]1C[C@H](N)CCC1
Synonyms:- Cyclohexanamine, 3-methyl-, trans-
- Cyclohexanamine, 3-methyl-, (1R,3R)-rel-
- rel-(1R,3R)-3-Methylcyclohexanamine
- trans-3-Methylcyclohexylamine
- Cyclohexylamine, 3-methyl-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
