
CAS 1193-66-4
:2-Methyl-1,4-diazabicyclo[2.2.2]octane
Description:
2-Methyl-1,4-diazabicyclo[2.2.2]octane, commonly referred to as DMBA, is a bicyclic organic compound characterized by its unique structure, which includes two nitrogen atoms in a bicyclic framework. This compound is a derivative of the bicyclic system known as bicyclo[2.2.2]octane, with a methyl group attached to one of the nitrogen atoms. DMBA is known for its basicity due to the presence of the nitrogen atoms, which can participate in protonation reactions. It is often utilized in organic synthesis and as a ligand in coordination chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its solubility in polar solvents makes it useful in various chemical applications. Additionally, DMBA has been studied for its potential biological activities, although safety and handling precautions are necessary due to its reactivity and potential toxicity. Overall, 2-Methyl-1,4-diazabicyclo[2.2.2]octane is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-7-6-8-2-4-9(7)5-3-8/h7H,2-6H2,1H3
InChI key:InChIKey=QXKMWFFBWDHDCB-UHFFFAOYSA-N
SMILES:CC1N2CCN(C1)CC2
Synonyms:- 1,4-Diazabicyclo[2.2.2]octane, 2-methyl-
- C-Methyltriethylenediamine
- 2-Methyltriethylenediamine
- Methyl-1,4-diazabicyclo[2.2.2]octane
- 2-Methyl-1,4-diazabicyclo[2.2.2]octane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
