
CAS 119301-02-9
:Octanediimidamide
Description:
Octanediimidamide, identified by its CAS number 119301-02-9, is a chemical compound characterized by its structure, which features two imidamide functional groups separated by an octane chain. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents. Its molecular structure suggests potential applications in various fields, including materials science and pharmaceuticals, due to its ability to form hydrogen bonds and interact with other molecules. The presence of imidamide groups indicates that it may exhibit properties such as biocompatibility and the ability to act as a ligand in coordination chemistry. Additionally, octanediimidamide may possess interesting thermal and chemical stability, making it suitable for use in diverse chemical reactions or as a building block in the synthesis of more complex molecules. However, specific data regarding its reactivity, toxicity, and detailed applications would require further investigation and should be approached with caution in laboratory settings.
Formula:C8H18N4
InChI:InChI=1S/C8H18N4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H3,9,10)(H3,11,12)
InChI key:InChIKey=BVHMSBKWWMXRLG-UHFFFAOYSA-N
SMILES:C(CC(=N)N)CCCCC(=N)N
Synonyms:- Octanediimidamide
- Suberamidine
- 1,6-Diamidinohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
